![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 04 - Empty Spaces.mp3 | 2023-02-11 17:11 | 447K | |
| 02 - The Radiance.mp3 | 2023-02-11 17:11 | 1.4M | |
| 13 - Fallout.mp3 | 2023-02-11 17:11 | 1.7M | |
| 07 - Jornada del Muerto.mp3 | 2023-02-11 17:11 | 2.0M | |
| 11 - Wisdom, Justice, and Love.mp3 | 2023-02-11 17:11 | 2.0M | |
| 01 - The Requiem.mp3 | 2023-02-11 17:11 | 2.7M | |
| 15 - The Messenger.mp3 | 2023-02-11 17:11 | 2.9M | |
| 08 - Waiting for the End.mp3 | 2023-02-11 17:11 | 5.2M | |
| 10 - Wretches and Kings.mp3 | 2023-02-11 17:11 | 5.3M | |
| 03 - Burning in the Skies.mp3 | 2023-02-11 17:11 | 5.7M | |
| 09 - Blackout.mp3 | 2023-02-11 17:11 | 6.4M | |
| 12 - Iridescent.mp3 | 2023-02-11 17:11 | 6.5M | |
| 05 - When They Come for Me.mp3 | 2023-02-11 17:11 | 6.8M | |
| 06 - Robot Boy.mp3 | 2023-02-11 17:11 | 6.9M | |
| 14 - The Catalyst.mp3 | 2023-02-11 17:11 | 7.4M | |